C18H18N2 — CID 142259487
4-[(Z)-2-(6-buta-1,3-dien-2-yl-3-pyridinyl)ethenyl]-N-methylaniline (PubChem CID 142259487) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(Z)-2-(6-buta-1,3-dien-2-yl-3-pyridinyl)ethenyl]-N-methylaniline.
| Compound Name | 4-[(Z)-2-(6-buta-1,3-dien-2-yl-3-pyridinyl)ethenyl]-N-methylaniline |
|---|---|
| PubChem CID | 142259487 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(Z)-2-(6-buta-1,3-dien-2-yl-3-pyridinyl)ethenyl]-N-methylaniline |
| SMILES | C=CC(=C)c1ccc(/C=C\c2ccc(NC)cc2)cn1 |
| InChI | InChI=1S/C18H18N2/c1-4-14(2)18-12-9-16(13-20-18)6-5-15-7-10-17(19-3)11-8-15/h4-13,19H,1-2H2,3H3/b6-5- |
| InChIKey | GYTFGNSGZFFCFW-WAYWQWQTSA-N |
| XLogP | 4.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|