C32H27F3N2O6 — CID 87735102
methyl 4-[3-[(E)-(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoate (PubChem CID 87735102) has the molecular formula C32H27F3N2O6 and a molecular weight of 592.57 g/mol. Its IUPAC name is methyl 4-[3-[(E)-(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoate.
| Compound Name | methyl 4-[3-[(E)-(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 87735102 |
| Molecular Formula | C32H27F3N2O6 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | methyl 4-[3-[(E)-(4-phenylphenyl)methylideneamino]oxypropoxy]-2-[[4-(trifluoromethoxy)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(OCCCO/N=C/c2ccc(-c3ccccc3)cc2)cc1NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H27F3N2O6/c1-40-31(39)28-17-16-27(20-29(28)37-30(38)25-12-14-26(15-13-25)43-32(33,34)35)41-18-5-19-42-36-21-22-8-10-24(11-9-22)23-6-3-2-4-7-23/h2-4,6-17,20-21H,5,18-19H2,1H3,(H,37,38)/b36-21+ |
| InChIKey | WMHKICHKTWVCRN-QLQYKETESA-N |
| XLogP | 7.11 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|