methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate

C21H15Cl2NO3 — CID 146601280

IUPACmethyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate
SMILESCOC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C21H15Cl2NO3/c1-27-21(26)18-8-7-14(13-5-3-2-4-6-13)11-19(18)24-20(25)15-9-16(22)12-17(23)10-15/h2-12H,1H3,(H,24,25)
InChIKeyJAAXKOHROILAON-UHFFFAOYSA-N
MW400.26 g/mol
LogP5.70
Rot. Bonds4

About methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate

methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate (PubChem CID 146601280) has the molecular formula C21H15Cl2NO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate
PubChem CID146601280
Molecular FormulaC21H15Cl2NO3
Molecular Weight400.26 g/mol
Exact Mass399.04
IUPAC Namemethyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate
SMILESCOC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C21H15Cl2NO3/c1-27-21(26)18-8-7-14(13-5-3-2-4-6-13)11-19(18)24-20(25)15-9-16(22)12-17(23)10-15/h2-12H,1H3,(H,24,25)
InChIKeyJAAXKOHROILAON-UHFFFAOYSA-N
XLogP5.70
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500400.26
LogP ≤ 55.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate?
The IUPAC name of methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate (CID 146601280) is methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate.
What is the SMILES notation for methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate?
The canonical SMILES for methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate is COC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate?
The InChIKey is JAAXKOHROILAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2NO3/c1-27-21(26)18-8-7-14(13-5-3-2-4-6-13)11-19(18)24-20(25)15-9-16(22)12-17(23)10-15/h2-12H,1H3,(H,24,25).
What are the key properties of methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate?
methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate has a molecular weight of 400.26 g/mol, XLogP of 5.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate is sourced from PubChem (CID 146601280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).