C21H15Cl2NO3 — CID 146601280
methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate (PubChem CID 146601280) has the molecular formula C21H15Cl2NO3 and a molecular weight of 400.26 g/mol. Its IUPAC name is methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate.
| Compound Name | methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 146601280 |
| Molecular Formula | C21H15Cl2NO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | methyl 2-[(3,5-dichlorobenzoyl)amino]-4-phenylbenzoate |
| SMILES | COC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2NO3/c1-27-21(26)18-8-7-14(13-5-3-2-4-6-13)11-19(18)24-20(25)15-9-16(22)12-17(23)10-15/h2-12H,1H3,(H,24,25) |
| InChIKey | JAAXKOHROILAON-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |