C20H13Cl2NO4 — CID 67344063
2-[(3,5-dichlorobenzoyl)amino]-4-phenoxybenzoic acid (PubChem CID 67344063) has the molecular formula C20H13Cl2NO4 and a molecular weight of 402.23 g/mol. Its IUPAC name is 2-[(3,5-dichlorobenzoyl)amino]-4-phenoxybenzoic acid.
| Compound Name | 2-[(3,5-dichlorobenzoyl)amino]-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 67344063 |
| Molecular Formula | C20H13Cl2NO4 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[(3,5-dichlorobenzoyl)amino]-4-phenoxybenzoic acid |
| SMILES | O=C(Nc1cc(Oc2ccccc2)ccc1C(=O)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H13Cl2NO4/c21-13-8-12(9-14(22)10-13)19(24)23-18-11-16(6-7-17(18)20(25)26)27-15-4-2-1-3-5-15/h1-11H,(H,23,24)(H,25,26) |
| InChIKey | RFDDEKZVFCZEKE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |