C23H16N2O4S — CID 67343096
4-phenoxy-2-[(2-phenyl-1,3-thiazole-4-carbonyl)amino]benzoic acid (PubChem CID 67343096) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-phenoxy-2-[(2-phenyl-1,3-thiazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 4-phenoxy-2-[(2-phenyl-1,3-thiazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 67343096 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-phenoxy-2-[(2-phenyl-1,3-thiazole-4-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1cc(Oc2ccccc2)ccc1C(=O)O)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H16N2O4S/c26-21(20-14-30-22(25-20)15-7-3-1-4-8-15)24-19-13-17(11-12-18(19)23(27)28)29-16-9-5-2-6-10-16/h1-14H,(H,24,26)(H,27,28) |
| InChIKey | BIMGLTXMTHUKHW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |