C17H14F3NO2 — CID 23141524
4-methoxy-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzamide (PubChem CID 23141524) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 4-methoxy-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzamide.
| Compound Name | 4-methoxy-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 23141524 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-methoxy-3-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO2/c1-23-15-9-6-13(16(21)22)10-12(15)5-2-11-3-7-14(8-4-11)17(18,19)20/h2-10H,1H3,(H2,21,22)/b5-2+ |
| InChIKey | KUUFSWNUCVBKEG-GORDUTHDSA-N |
| XLogP | 3.98 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|