C25H25ClN2O4 — CID 174534919
tert-butyl 4-[4-(aminomethyl)-3-chlorophenyl]-2-benzamidobenzenecarboperoxoate (PubChem CID 174534919) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is tert-butyl 4-[4-(aminomethyl)-3-chlorophenyl]-2-benzamidobenzenecarboperoxoate.
| Compound Name | tert-butyl 4-[4-(aminomethyl)-3-chlorophenyl]-2-benzamidobenzenecarboperoxoate |
|---|---|
| PubChem CID | 174534919 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | tert-butyl 4-[4-(aminomethyl)-3-chlorophenyl]-2-benzamidobenzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1ccc(-c2ccc(CN)c(Cl)c2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-25(2,3)32-31-24(30)20-12-11-18(17-9-10-19(15-27)21(26)13-17)14-22(20)28-23(29)16-7-5-4-6-8-16/h4-14H,15,27H2,1-3H3,(H,28,29) |
| InChIKey | IGCOKMAKWQSANZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|