C24H22ClN3O2 — CID 174591618
N-[2-(aminomethyl)-5-(cyclopropylcarbamoyl)phenyl]-2-chloro-5-phenylbenzamide (PubChem CID 174591618) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-[2-(aminomethyl)-5-(cyclopropylcarbamoyl)phenyl]-2-chloro-5-phenylbenzamide.
| Compound Name | N-[2-(aminomethyl)-5-(cyclopropylcarbamoyl)phenyl]-2-chloro-5-phenylbenzamide |
|---|---|
| PubChem CID | 174591618 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[2-(aminomethyl)-5-(cyclopropylcarbamoyl)phenyl]-2-chloro-5-phenylbenzamide |
| SMILES | NCc1ccc(C(=O)NC2CC2)cc1NC(=O)c1cc(-c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C24H22ClN3O2/c25-21-11-8-16(15-4-2-1-3-5-15)12-20(21)24(30)28-22-13-17(6-7-18(22)14-26)23(29)27-19-9-10-19/h1-8,11-13,19H,9-10,14,26H2,(H,27,29)(H,28,30) |
| InChIKey | UZXJYUVYLPRAFU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |