C26H23Cl2NO4 — CID 174548832
tert-butyl 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzenecarboperoxoate (PubChem CID 174548832) has the molecular formula C26H23Cl2NO4 and a molecular weight of 484.38 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzenecarboperoxoate.
| Compound Name | tert-butyl 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 174548832 |
| Molecular Formula | C26H23Cl2NO4 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | tert-butyl 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1ccc(C=Cc2ccccc2NC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C26H23Cl2NO4/c1-26(2,3)33-32-25(31)19-15-12-17(13-16-19)11-14-18-7-4-5-10-22(18)29-24(30)23-20(27)8-6-9-21(23)28/h4-16H,1-3H3,(H,29,30) |
| InChIKey | BDRUEDGJWYVQKG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|