C22H15Cl2NO3 — CID 174535080
4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzoic acid (PubChem CID 174535080) has the molecular formula C22H15Cl2NO3 and a molecular weight of 412.27 g/mol. Its IUPAC name is 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 174535080 |
| Molecular Formula | C22H15Cl2NO3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-[2-[2-[(2,6-dichlorobenzoyl)amino]phenyl]ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C=Cc2ccccc2NC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C22H15Cl2NO3/c23-17-5-3-6-18(24)20(17)21(26)25-19-7-2-1-4-15(19)11-8-14-9-12-16(13-10-14)22(27)28/h1-13H,(H,25,26)(H,27,28) |
| InChIKey | FAAOEGUPQNEUQB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|