C15H10F3NO — CID 101479508
(E)-3-phenyl-N-(2,3,5-trifluorophenyl)prop-2-enamide (PubChem CID 101479508) has the molecular formula C15H10F3NO and a molecular weight of 277.25 g/mol. Its IUPAC name is (E)-3-phenyl-N-(2,3,5-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(2,3,5-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 101479508 |
| Molecular Formula | C15H10F3NO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (E)-3-phenyl-N-(2,3,5-trifluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C15H10F3NO/c16-11-8-12(17)15(18)13(9-11)19-14(20)7-6-10-4-2-1-3-5-10/h1-9H,(H,19,20)/b7-6+ |
| InChIKey | KPYMIIRNRUVMEO-VOTSOKGWSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|