C19H16O8 — CID 85325543
1,7-bis(3,4,5-trihydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 85325543) has the molecular formula C19H16O8 and a molecular weight of 372.33 g/mol. Its IUPAC name is 1,7-bis(3,4,5-trihydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis(3,4,5-trihydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 85325543 |
| Molecular Formula | C19H16O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1,7-bis(3,4,5-trihydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1cc(O)c(O)c(O)c1)CC(=O)C=Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H16O8/c20-12(3-1-10-5-14(22)18(26)15(23)6-10)9-13(21)4-2-11-7-16(24)19(27)17(25)8-11/h1-8,22-27H,9H2 |
| InChIKey | GIDVLQQBDXIXMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|