C17H15NO5 — CID 142900112
(E)-N-(2-formyl-4-hydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 142900112) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (E)-N-(2-formyl-4-hydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-formyl-4-hydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 142900112 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (E)-N-(2-formyl-4-hydroxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(O)cc2C=O)ccc1O |
| InChI | InChI=1S/C17H15NO5/c1-23-16-8-11(2-6-15(16)21)3-7-17(22)18-14-5-4-13(20)9-12(14)10-19/h2-10,20-21H,1H3,(H,18,22)/b7-3+ |
| InChIKey | JDMDZBKUROWBIF-XVNBXDOJSA-N |
| XLogP | 2.57 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|