C21H22N2O6 — CID 9400156
N'-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9400156) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is N'-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9400156 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N'-[(E)-3-(3,4-diethoxyphenyl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | CCOc1ccc(/C=C/C(=O)NNC(=O)c2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C21H22N2O6/c1-3-26-16-8-5-14(11-18(16)27-4-2)6-10-20(24)22-23-21(25)15-7-9-17-19(12-15)29-13-28-17/h5-12H,3-4,13H2,1-2H3,(H,22,24)(H,23,25)/b10-6+ |
| InChIKey | IJFQWSWOOBIMBP-UXBLZVDNSA-N |
| XLogP | 2.69 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|