C16H15BrO4S — CID 19569502
(E)-1-(4-bromothiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 19569502) has the molecular formula C16H15BrO4S and a molecular weight of 383.26 g/mol. Its IUPAC name is (E)-1-(4-bromothiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromothiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19569502 |
| Molecular Formula | C16H15BrO4S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | (E)-1-(4-bromothiophen-2-yl)-3-(2,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)c1cc(Br)cs1 |
| InChI | InChI=1S/C16H15BrO4S/c1-19-13-8-15(21-3)14(20-2)6-10(13)4-5-12(18)16-7-11(17)9-22-16/h4-9H,1-3H3/b5-4+ |
| InChIKey | MHPUIAJQCTUDOU-SNAWJCMRSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|