C17H18ClNO6 — CID 8660925
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8660925) has the molecular formula C17H18ClNO6 and a molecular weight of 367.79 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8660925 |
| Molecular Formula | C17H18ClNO6 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C17H18ClNO6/c18-13-6-11(7-14-17(13)25-10-24-14)3-4-16(21)23-9-15(20)19-8-12-2-1-5-22-12/h3-4,6-7,12H,1-2,5,8-10H2,(H,19,20)/b4-3+/t12-/m1/s1 |
| InChIKey | SAJLLXAWTJIWAW-AAOUONPWSA-N |
| XLogP | 1.92 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|