C14H19BrN2O3 — CID 95158953
1-[(3-bromo-4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 95158953) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95158953 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[(3-bromo-4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC[C@H]2CCCO2)cc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-19-13-5-4-10(7-12(13)15)8-16-14(18)17-9-11-3-2-6-20-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H2,16,17,18)/t11-/m1/s1 |
| InChIKey | USENQVQZOQHLMQ-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |