C11H15BrN2O2S — CID 95310612
1-[(3-bromothiophen-2-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95310612) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95310612 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NCc1sccc1Br)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H15BrN2O2S/c12-9-3-5-17-10(9)7-14-11(15)13-6-8-2-1-4-16-8/h3,5,8H,1-2,4,6-7H2,(H2,13,14,15)/t8-/m0/s1 |
| InChIKey | LBHLHUOVSGMBQW-QMMMGPOBSA-N |
| XLogP | 2.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |