C12H19BrN2OS — CID 105267511
[1-(3-bromothiophen-2-yl)-3-(oxan-2-yl)propan-2-yl]hydrazine (PubChem CID 105267511) has the molecular formula C12H19BrN2OS and a molecular weight of 319.27 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-3-(oxan-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-3-(oxan-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105267511 |
| Molecular Formula | C12H19BrN2OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-3-(oxan-2-yl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1sccc1Br)CC1CCCCO1 |
| InChI | InChI=1S/C12H19BrN2OS/c13-11-4-6-17-12(11)8-9(15-14)7-10-3-1-2-5-16-10/h4,6,9-10,15H,1-3,5,7-8,14H2 |
| InChIKey | IBVQFKHTSSIIJD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|