C24H25N3O5 — CID 55415663
2-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55415663) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55415663 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)NCC2CCCO2)ccc1OCC#N |
| InChI | InChI=1S/C24H25N3O5/c1-30-22-15-17(8-10-21(22)32-14-12-25)9-11-23(28)27-20-7-3-2-6-19(20)24(29)26-16-18-5-4-13-31-18/h2-3,6-11,15,18H,4-5,13-14,16H2,1H3,(H,26,29)(H,27,28)/b11-9+ |
| InChIKey | CAJGVOJJJZDBRV-PKNBQFBNSA-N |
| XLogP | 3.16 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|