C25H27N3O4 — CID 146373898
2-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoylamino]-N-piperidin-4-ylbenzamide (PubChem CID 146373898) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoylamino]-N-piperidin-4-ylbenzamide.
| Compound Name | 2-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoylamino]-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 146373898 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[3-(3-methoxy-4-prop-2-ynoxyphenyl)prop-2-enoylamino]-N-piperidin-4-ylbenzamide |
| SMILES | C#CCOc1ccc(C=CC(=O)Nc2ccccc2C(=O)NC2CCNCC2)cc1OC |
| InChI | InChI=1S/C25H27N3O4/c1-3-16-32-22-10-8-18(17-23(22)31-2)9-11-24(29)28-21-7-5-4-6-20(21)25(30)27-19-12-14-26-15-13-19/h1,4-11,17,19,26H,12-16H2,2H3,(H,27,30)(H,28,29) |
| InChIKey | ZDTNEPWSMPRHAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|