C23H30ClN3O4 — CID 67648367
N-[2-(dimethylamino)ethyl]-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzamide;hydrochloride (PubChem CID 67648367) has the molecular formula C23H30ClN3O4 and a molecular weight of 447.96 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 67648367 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[3-(4-ethoxy-3-methoxyphenyl)prop-2-enoylamino]benzamide;hydrochloride |
| SMILES | CCOc1ccc(C=CC(=O)Nc2ccccc2C(=O)NCCN(C)C)cc1OC.Cl |
| InChI | InChI=1S/C23H29N3O4.ClH/c1-5-30-20-12-10-17(16-21(20)29-4)11-13-22(27)25-19-9-7-6-8-18(19)23(28)24-14-15-26(2)3;/h6-13,16H,5,14-15H2,1-4H3,(H,24,28)(H,25,27);1H |
| InChIKey | ADIOCEVFIPCKOU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|