C15H19Cl2N3O3 — CID 3702390
ethyl 2-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]acetate (PubChem CID 3702390) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is ethyl 2-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 3702390 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | ethyl 2-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(C(=O)Nc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-2-23-13(21)10-19-6-8-20(9-7-19)15(22)18-14-11(16)4-3-5-12(14)17/h3-5H,2,6-10H2,1H3,(H,18,22) |
| InChIKey | NAADTVUDIMTIEZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |