C16H22BrN3O3 — CID 3721507
ethyl 2-[4-[(4-bromo-2-methylphenyl)carbamoyl]piperazin-1-yl]acetate (PubChem CID 3721507) has the molecular formula C16H22BrN3O3 and a molecular weight of 384.27 g/mol. Its IUPAC name is ethyl 2-[4-[(4-bromo-2-methylphenyl)carbamoyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(4-bromo-2-methylphenyl)carbamoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 3721507 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | ethyl 2-[4-[(4-bromo-2-methylphenyl)carbamoyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(C(=O)Nc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C16H22BrN3O3/c1-3-23-15(21)11-19-6-8-20(9-7-19)16(22)18-14-5-4-13(17)10-12(14)2/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,22) |
| InChIKey | WGWLVDGFYLOFFB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |