C17H24BrN3O3 — CID 109003675
ethyl 4-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]piperidine-1-carboxylate (PubChem CID 109003675) has the molecular formula C17H24BrN3O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is ethyl 4-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109003675 |
| Molecular Formula | C17H24BrN3O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | ethyl 4-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCC(=O)Nc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C17H24BrN3O3/c1-3-24-17(23)21-8-6-14(7-9-21)19-11-16(22)20-15-5-4-13(18)10-12(15)2/h4-5,10,14,19H,3,6-9,11H2,1-2H3,(H,20,22) |
| InChIKey | YJCBOQOGJSPPSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |