C28H32Cl2N4O3 — CID 130311804
N-[4-[4-[[2,6-dichloro-4-(hydroxymethyl)anilino]-hydroxymethyl]piperazin-1-yl]phenyl]-4-phenylbutanamide (PubChem CID 130311804) has the molecular formula C28H32Cl2N4O3 and a molecular weight of 543.50 g/mol. Its IUPAC name is N-[4-[4-[[2,6-dichloro-4-(hydroxymethyl)anilino]-hydroxymethyl]piperazin-1-yl]phenyl]-4-phenylbutanamide.
| Compound Name | N-[4-[4-[[2,6-dichloro-4-(hydroxymethyl)anilino]-hydroxymethyl]piperazin-1-yl]phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 130311804 |
| Molecular Formula | C28H32Cl2N4O3 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | N-[4-[4-[[2,6-dichloro-4-(hydroxymethyl)anilino]-hydroxymethyl]piperazin-1-yl]phenyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)Nc1ccc(N2CCN(C(O)Nc3c(Cl)cc(CO)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C28H32Cl2N4O3/c29-24-17-21(19-35)18-25(30)27(24)32-28(37)34-15-13-33(14-16-34)23-11-9-22(10-12-23)31-26(36)8-4-7-20-5-2-1-3-6-20/h1-3,5-6,9-12,17-18,28,32,35,37H,4,7-8,13-16,19H2,(H,31,36) |
| InChIKey | CDANZYBDZAOFBJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|