C24H31N3O3 — CID 14209810
methyl 4-[4-[3-(4-phenylpiperazin-1-yl)propanoylamino]phenyl]butanoate (PubChem CID 14209810) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 4-[4-[3-(4-phenylpiperazin-1-yl)propanoylamino]phenyl]butanoate.
| Compound Name | methyl 4-[4-[3-(4-phenylpiperazin-1-yl)propanoylamino]phenyl]butanoate |
|---|---|
| PubChem CID | 14209810 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | methyl 4-[4-[3-(4-phenylpiperazin-1-yl)propanoylamino]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(NC(=O)CCN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-30-24(29)9-5-6-20-10-12-21(13-11-20)25-23(28)14-15-26-16-18-27(19-17-26)22-7-3-2-4-8-22/h2-4,7-8,10-13H,5-6,9,14-19H2,1H3,(H,25,28) |
| InChIKey | MTEIBMKZYKCROQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |