C21H25N3O3 — CID 113111486
methyl 3-[4-[(2,4-dimethylphenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113111486) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 3-[4-[(2,4-dimethylphenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 3-[4-[(2,4-dimethylphenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113111486 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | methyl 3-[4-[(2,4-dimethylphenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2CCN(C(=O)Nc3ccc(C)cc3C)CC2)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-15-7-8-19(16(2)13-15)22-21(26)24-11-9-23(10-12-24)18-6-4-5-17(14-18)20(25)27-3/h4-8,13-14H,9-12H2,1-3H3,(H,22,26) |
| InChIKey | JZGRYYKEJNFWPT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |