C18H26N4O5S — CID 55534293
methyl 2-[4-[1-(cyclopropylamino)-1-oxopropan-2-yl]piperazin-1-yl]-5-sulfamoylbenzoate (PubChem CID 55534293) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 2-[4-[1-(cyclopropylamino)-1-oxopropan-2-yl]piperazin-1-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[4-[1-(cyclopropylamino)-1-oxopropan-2-yl]piperazin-1-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55534293 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl 2-[4-[1-(cyclopropylamino)-1-oxopropan-2-yl]piperazin-1-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCN(C(C)C(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C18H26N4O5S/c1-12(17(23)20-13-3-4-13)21-7-9-22(10-8-21)16-6-5-14(28(19,25)26)11-15(16)18(24)27-2/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,20,23)(H2,19,25,26) |
| InChIKey | WRDUFUGYUKMTTH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |