C20H23N3O6S2 — CID 55539490
methyl 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-5-sulfamoylbenzoate (PubChem CID 55539490) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55539490 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | methyl 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O6S2/c1-29-20(24)18-15-17(31(21,27)28)7-8-19(18)22-10-12-23(13-11-22)30(25,26)14-9-16-5-3-2-4-6-16/h2-9,14-15H,10-13H2,1H3,(H2,21,27,28)/b14-9+ |
| InChIKey | KUGAMEFPHISIBB-NTEUORMPSA-N |
| XLogP | 1.24 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |