C30H30ClN5O5 — CID 43914829
N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43914829) has the molecular formula C30H30ClN5O5 and a molecular weight of 576.05 g/mol. Its IUPAC name is N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43914829 |
| Molecular Formula | C30H30ClN5O5 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCN(C(=O)/C=C/c2ccccc2)CC1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H30ClN5O5/c31-24-8-10-26(33-12-14-35(15-13-33)29(37)11-6-22-4-2-1-3-5-22)25(21-24)32-30(38)23-7-9-27(28(20-23)36(39)40)34-16-18-41-19-17-34/h1-11,20-21H,12-19H2,(H,32,38)/b11-6+ |
| InChIKey | NEHUVMKKKBSDTF-IZZDOVSWSA-N |
| XLogP | 4.70 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|