C28H23Cl2N3O2S — CID 43914233
3-chloro-N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 43914233) has the molecular formula C28H23Cl2N3O2S and a molecular weight of 536.48 g/mol. Its IUPAC name is 3-chloro-N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43914233 |
| Molecular Formula | C28H23Cl2N3O2S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 3-chloro-N-[5-chloro-2-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCN(C(=O)/C=C/c2ccccc2)CC1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C28H23Cl2N3O2S/c29-20-11-12-23(22(18-20)31-28(35)27-26(30)21-8-4-5-9-24(21)36-27)32-14-16-33(17-15-32)25(34)13-10-19-6-2-1-3-7-19/h1-13,18H,14-17H2,(H,31,35)/b13-10+ |
| InChIKey | BGIGEUXAIMLPRB-JLHYYAGUSA-N |
| XLogP | 6.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|