C26H26ClN3O5 — CID 168539381
5-[[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168539381) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is 5-[[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539381 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 5-[[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2cc(Cl)ccc2N2CCN(C(=O)C=Cc3ccccc3)CC2)C(=O)O1 |
| InChI | InChI=1S/C26H26ClN3O5/c1-26(2)34-24(32)20(25(33)35-26)17-28-21-16-19(27)9-10-22(21)29-12-14-30(15-13-29)23(31)11-8-18-6-4-3-5-7-18/h3-11,16-17,28H,12-15H2,1-2H3 |
| InChIKey | CWIDXSRUKBOYER-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|