C26H24ClN5O3 — CID 168548612
methyl 3-amino-1-[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168548612) has the molecular formula C26H24ClN5O3 and a molecular weight of 489.96 g/mol. Its IUPAC name is methyl 3-amino-1-[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548612 |
| Molecular Formula | C26H24ClN5O3 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 3-amino-1-[5-chloro-2-[4-(3-phenylprop-2-enoyl)piperazin-1-yl]phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cc(Cl)ccc1N1CCN(C(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H24ClN5O3/c1-35-26(34)25-24(29)19(16-28)17-32(25)22-15-20(27)8-9-21(22)30-11-13-31(14-12-30)23(33)10-7-18-5-3-2-4-6-18/h2-10,15,17H,11-14,29H2,1H3 |
| InChIKey | HNYJMYATWBZNHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|