C23H25N5O4S — CID 43982896
[4-(6-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 43982896) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is [4-(6-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [4-(6-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 43982896 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [4-(6-methyl-1,3-benzothiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc2nc(N3CCN(C(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)CC3)sc2c1 |
| InChI | InChI=1S/C23H25N5O4S/c1-16-2-4-18-21(14-16)33-23(24-18)27-8-6-26(7-9-27)22(29)17-3-5-19(20(15-17)28(30)31)25-10-12-32-13-11-25/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | XZGGEIPRHUCJFS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|