C25H30N6O3S — CID 42800119
[4-(11-ethyl-5-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42800119) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is [4-(11-ethyl-5-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(11-ethyl-5-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42800119 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [4-(11-ethyl-5-propyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CCCc1nc(N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)c2c3c(sc2n1)CN(CC)CC3 |
| InChI | InChI=1S/C25H30N6O3S/c1-3-5-21-26-23(22-19-10-11-28(4-2)16-20(19)35-24(22)27-21)29-12-14-30(15-13-29)25(32)17-6-8-18(9-7-17)31(33)34/h6-9H,3-5,10-16H2,1-2H3 |
| InChIKey | MZMPNROGHAZZNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|