C22H27N5OS2 — CID 42800168
[4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 42800168) has the molecular formula C22H27N5OS2 and a molecular weight of 441.63 g/mol. Its IUPAC name is [4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 42800168 |
| Molecular Formula | C22H27N5OS2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CCc1nc(N2CCN(C(=O)c3cccs3)CC2)c2c3c(sc2n1)CN(CC)CC3 |
| InChI | InChI=1S/C22H27N5OS2/c1-3-18-23-20(19-15-7-8-25(4-2)14-17(15)30-21(19)24-18)26-9-11-27(12-10-26)22(28)16-6-5-13-29-16/h5-6,13H,3-4,7-12,14H2,1-2H3 |
| InChIKey | BTNCROAOEMARFH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |