C19H28N4OS — CID 42803173
4-[11-ethyl-5-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]morpholine (PubChem CID 42803173) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 4-[11-ethyl-5-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]morpholine.
| Compound Name | 4-[11-ethyl-5-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]morpholine |
|---|---|
| PubChem CID | 42803173 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-[11-ethyl-5-(2-methylpropyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl]morpholine |
| SMILES | CCN1CCc2c(sc3nc(CC(C)C)nc(N4CCOCC4)c23)C1 |
| InChI | InChI=1S/C19H28N4OS/c1-4-22-6-5-14-15(12-22)25-19-17(14)18(23-7-9-24-10-8-23)20-16(21-19)11-13(2)3/h13H,4-12H2,1-3H3 |
| InChIKey | MHCYMAXVFAJRAA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |