C24H28BrN5OS — CID 42800177
(4-bromophenyl)-[4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone (PubChem CID 42800177) has the molecular formula C24H28BrN5OS and a molecular weight of 514.49 g/mol. Its IUPAC name is (4-bromophenyl)-[4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone.
| Compound Name | (4-bromophenyl)-[4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42800177 |
| Molecular Formula | C24H28BrN5OS |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (4-bromophenyl)-[4-(5,11-diethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]methanone |
| SMILES | CCc1nc(N2CCN(C(=O)c3ccc(Br)cc3)CC2)c2c3c(sc2n1)CN(CC)CC3 |
| InChI | InChI=1S/C24H28BrN5OS/c1-3-20-26-22(21-18-9-10-28(4-2)15-19(18)32-23(21)27-20)29-11-13-30(14-12-29)24(31)16-5-7-17(25)8-6-16/h5-8H,3-4,9-15H2,1-2H3 |
| InChIKey | KKRLRFLTDRNJOT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |