C32H36N4OS — CID 42803420
[4-(5-butyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 42803420) has the molecular formula C32H36N4OS and a molecular weight of 524.73 g/mol. Its IUPAC name is [4-(5-butyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-(5-butyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 42803420 |
| Molecular Formula | C32H36N4OS |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | [4-(5-butyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl)piperazin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CCCCc1nc(N2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C32H36N4OS/c1-2-3-14-28-33-30(29-26-12-8-5-9-13-27(26)38-31(29)34-28)35-19-21-36(22-20-35)32(37)25-17-15-24(16-18-25)23-10-6-4-7-11-23/h4,6-7,10-11,15-18H,2-3,5,8-9,12-14,19-22H2,1H3 |
| InChIKey | LOGBOVCTGBRCHO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |