C28H34N4OS — CID 93117903
[4-(2-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-[(1S,2R)-2-phenylcyclopropyl]methanone (PubChem CID 93117903) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is [4-(2-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-[(1S,2R)-2-phenylcyclopropyl]methanone.
| Compound Name | [4-(2-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-[(1S,2R)-2-phenylcyclopropyl]methanone |
|---|---|
| PubChem CID | 93117903 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [4-(2-butyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-[(1S,2R)-2-phenylcyclopropyl]methanone |
| SMILES | CCCCc1nc(N2CCN(C(=O)[C@H]3C[C@H]3c3ccccc3)CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C28H34N4OS/c1-2-3-13-24-29-26(25-20-11-7-8-12-23(20)34-27(25)30-24)31-14-16-32(17-15-31)28(33)22-18-21(22)19-9-5-4-6-10-19/h4-6,9-10,21-22H,2-3,7-8,11-18H2,1H3/t21-,22-/m0/s1 |
| InChIKey | HSIUGZGYRSUZJT-VXKWHMMOSA-N |
| XLogP | 5.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |