C30H41N5OS — CID 42799872
N-[2,6-di(propan-2-yl)phenyl]-4-(2-propyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 42799872) has the molecular formula C30H41N5OS and a molecular weight of 519.76 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-4-(2-propyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-4-(2-propyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42799872 |
| Molecular Formula | C30H41N5OS |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-4-(2-propyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | CCCc1nc(N2CCN(C(=O)Nc3c(C(C)C)cccc3C(C)C)CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C30H41N5OS/c1-6-10-25-31-28(26-23-11-7-8-14-24(23)37-29(26)32-25)34-15-17-35(18-16-34)30(36)33-27-21(19(2)3)12-9-13-22(27)20(4)5/h9,12-13,19-20H,6-8,10-11,14-18H2,1-5H3,(H,33,36) |
| InChIKey | LZEQSNWEHFLQTR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |