C29H33N5O3S2 — CID 42800256
5-benzyl-11-ethyl-3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene (PubChem CID 42800256) has the molecular formula C29H33N5O3S2 and a molecular weight of 563.75 g/mol. Its IUPAC name is 5-benzyl-11-ethyl-3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene.
| Compound Name | 5-benzyl-11-ethyl-3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
|---|---|
| PubChem CID | 42800256 |
| Molecular Formula | C29H33N5O3S2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 5-benzyl-11-ethyl-3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene |
| SMILES | CCN1CCc2c(sc3nc(Cc4ccccc4)nc(N4CCN(S(=O)(=O)c5ccc(OC)cc5)CC4)c23)C1 |
| InChI | InChI=1S/C29H33N5O3S2/c1-3-32-14-13-24-25(20-32)38-29-27(24)28(30-26(31-29)19-21-7-5-4-6-8-21)33-15-17-34(18-16-33)39(35,36)23-11-9-22(37-2)10-12-23/h4-12H,3,13-20H2,1-2H3 |
| InChIKey | OLPSXFLIJPFFQJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |