C22H24N4OS — CID 91965838
4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbaldehyde (PubChem CID 91965838) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbaldehyde.
| Compound Name | 4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 91965838 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-(2-benzyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2nc(Cc3ccccc3)nc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C22H24N4OS/c27-15-25-10-12-26(13-11-25)21-20-17-8-4-5-9-18(17)28-22(20)24-19(23-21)14-16-6-2-1-3-7-16/h1-3,6-7,15H,4-5,8-14H2 |
| InChIKey | POLSTUUWMINMOU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|