C22H28N4S — CID 42803178
5-benzyl-N,N,11-triethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 42803178) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is 5-benzyl-N,N,11-triethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-benzyl-N,N,11-triethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 42803178 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-benzyl-N,N,11-triethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCN1CCc2c(sc3nc(Cc4ccccc4)nc(N(CC)CC)c23)C1 |
| InChI | InChI=1S/C22H28N4S/c1-4-25-13-12-17-18(15-25)27-22-20(17)21(26(5-2)6-3)23-19(24-22)14-16-10-8-7-9-11-16/h7-11H,4-6,12-15H2,1-3H3 |
| InChIKey | YVZVAHDUKRBZMX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |