C29H26N6O4 — CID 42874871
[4-(3-naphthalen-2-yl-6-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42874871) has the molecular formula C29H26N6O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is [4-(3-naphthalen-2-yl-6-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(3-naphthalen-2-yl-6-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42874871 |
| Molecular Formula | C29H26N6O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [4-(3-naphthalen-2-yl-6-propyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CCCc1nc(N2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)c2c(-c3ccc4ccccc4c3)noc2n1 |
| InChI | InChI=1S/C29H26N6O4/c1-2-5-24-30-27(33-14-16-34(17-15-33)29(36)20-10-12-23(13-11-20)35(37)38)25-26(32-39-28(25)31-24)22-9-8-19-6-3-4-7-21(19)18-22/h3-4,6-13,18H,2,5,14-17H2,1H3 |
| InChIKey | BXXMRACGULWNGJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 118.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|