C26H31FN4OS — CID 93122717
[4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 93122717) has the molecular formula C26H31FN4OS and a molecular weight of 466.63 g/mol. Its IUPAC name is [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 93122717 |
| Molecular Formula | C26H31FN4OS |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | CC[C@H](C)c1nc(N2CCN(C(=O)c3ccccc3F)CC2)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C26H31FN4OS/c1-3-17(2)23-28-24(22-19-10-5-4-6-12-21(19)33-25(22)29-23)30-13-15-31(16-14-30)26(32)18-9-7-8-11-20(18)27/h7-9,11,17H,3-6,10,12-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | QBCUVCZGKZORRL-KRWDZBQOSA-N |
| XLogP | 5.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |