C28H36N4OS — CID 93122706
1-[4-[5-[(2R)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-3-phenylpropan-1-one (PubChem CID 93122706) has the molecular formula C28H36N4OS and a molecular weight of 476.69 g/mol. Its IUPAC name is 1-[4-[5-[(2R)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[5-[(2R)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 93122706 |
| Molecular Formula | C28H36N4OS |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 1-[4-[5-[(2R)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-3-phenylpropan-1-one |
| SMILES | CC[C@@H](C)c1nc(N2CCN(C(=O)CCc3ccccc3)CC2)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C28H36N4OS/c1-3-20(2)26-29-27(25-22-12-8-5-9-13-23(22)34-28(25)30-26)32-18-16-31(17-19-32)24(33)15-14-21-10-6-4-7-11-21/h4,6-7,10-11,20H,3,5,8-9,12-19H2,1-2H3/t20-/m1/s1 |
| InChIKey | XWJZDVPFXJFVOR-HXUWFJFHSA-N |
| XLogP | 5.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |