C26H30Cl2N4OS — CID 93122675
[4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 93122675) has the molecular formula C26H30Cl2N4OS and a molecular weight of 517.53 g/mol. Its IUPAC name is [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 93122675 |
| Molecular Formula | C26H30Cl2N4OS |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | [4-[5-[(2S)-butan-2-yl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yl]piperazin-1-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | CC[C@H](C)c1nc(N2CCN(C(=O)c3ccc(Cl)cc3Cl)CC2)c2c3c(sc2n1)CCCCC3 |
| InChI | InChI=1S/C26H30Cl2N4OS/c1-3-16(2)23-29-24(22-19-7-5-4-6-8-21(19)34-25(22)30-23)31-11-13-32(14-12-31)26(33)18-10-9-17(27)15-20(18)28/h9-10,15-16H,3-8,11-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | PPIGPYAPUZRPKC-INIZCTEOSA-N |
| XLogP | 6.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |