C21H17ClFN5O4 — CID 83290001
[4-[6-(3-chloro-4-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 83290001) has the molecular formula C21H17ClFN5O4 and a molecular weight of 457.85 g/mol. Its IUPAC name is [4-[6-(3-chloro-4-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[6-(3-chloro-4-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 83290001 |
| Molecular Formula | C21H17ClFN5O4 |
| Molecular Weight | 457.85 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [4-[6-(3-chloro-4-fluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(c2cc(Oc3ccc(F)c(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C21H17ClFN5O4/c22-17-11-16(4-5-18(17)23)32-20-12-19(24-13-25-20)26-6-8-27(9-7-26)21(29)14-2-1-3-15(10-14)28(30)31/h1-5,10-13H,6-9H2 |
| InChIKey | DUYKJUFZTMKLCU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|